C12H22O4 — CID 13457377
[(1S,3R)-3-(2,2-dimethoxyethyl)-2,2-dimethylcyclopropyl]methyl acetate (PubChem CID 13457377) has the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. Its IUPAC name is [(1S,3R)-3-(2,2-dimethoxyethyl)-2,2-dimethylcyclopropyl]methyl acetate.
| Compound Name | [(1S,3R)-3-(2,2-dimethoxyethyl)-2,2-dimethylcyclopropyl]methyl acetate |
|---|---|
| PubChem CID | 13457377 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | [(1S,3R)-3-(2,2-dimethoxyethyl)-2,2-dimethylcyclopropyl]methyl acetate |
| SMILES | COC(C[C@@H]1[C@H](COC(C)=O)C1(C)C)OC |
| InChI | InChI=1S/C12H22O4/c1-8(13)16-7-10-9(12(10,2)3)6-11(14-4)15-5/h9-11H,6-7H2,1-5H3/t9-,10+/m1/s1 |
| InChIKey | ZDJSNLHEWNLDFI-ZJUUUORDSA-N |
| XLogP | 1.83 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|