C19H22N4O3 — CID 7030411
5-[(2R,6R)-2,6-dimethylmorpholine-4-carbonyl]-6,10-dimethyl-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaen-2-one (PubChem CID 7030411) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is 5-[(2R,6R)-2,6-dimethylmorpholine-4-carbonyl]-6,10-dimethyl-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaen-2-one.
| Compound Name | 5-[(2R,6R)-2,6-dimethylmorpholine-4-carbonyl]-6,10-dimethyl-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaen-2-one |
|---|---|
| PubChem CID | 7030411 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 5-[(2R,6R)-2,6-dimethylmorpholine-4-carbonyl]-6,10-dimethyl-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaen-2-one |
| SMILES | Cc1cccn2c(=O)c3cc(C(=O)N4C[C@@H](C)O[C@H](C)C4)n(C)c3nc12 |
| InChI | InChI=1S/C19H22N4O3/c1-11-6-5-7-23-16(11)20-17-14(18(23)24)8-15(21(17)4)19(25)22-9-12(2)26-13(3)10-22/h5-8,12-13H,9-10H2,1-4H3/t12-,13-/m1/s1 |
| InChIKey | OYHBKBAHLASDIH-CHWSQXEVSA-N |
| XLogP | 1.74 |
| TPSA | 68.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |