C14H18N4O — CID 70304240
2-amino-8-cyclohexyl-4-methylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 70304240) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is 2-amino-8-cyclohexyl-4-methylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-amino-8-cyclohexyl-4-methylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 70304240 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 2-amino-8-cyclohexyl-4-methylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cc1nc(N)nc2c1ccc(=O)n2C1CCCCC1 |
| InChI | InChI=1S/C14H18N4O/c1-9-11-7-8-12(19)18(10-5-3-2-4-6-10)13(11)17-14(15)16-9/h7-8,10H,2-6H2,1H3,(H2,15,16,17) |
| InChIKey | GUODOASEWYIOFJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |