C15H19BN4O2 — CID 88936750
CID 88936750 (PubChem CID 88936750) has the molecular formula C15H19BN4O2 and a molecular weight of 298.16 g/mol.
| Compound Name | CID 88936750 |
|---|---|
| PubChem CID | 88936750 |
| Molecular Formula | C15H19BN4O2 |
| Molecular Weight | 298.16 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | — |
| SMILES | [B]c1cc2c(C)nc(N)nc2n(C2CCC(OC)CC2)c1=O |
| InChI | InChI=1S/C15H19BN4O2/c1-8-11-7-12(16)14(21)20(13(11)19-15(17)18-8)9-3-5-10(22-2)6-4-9/h7,9-10H,3-6H2,1-2H3,(H2,17,18,19) |
| InChIKey | SGHFKPYNJZMAHW-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.16 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|