C14H24F2N4O2 — CID 70307015
N-[(2S)-1-(aminomethylamino)-4,4-difluoro-1-oxopentan-2-yl]-6-azaspiro[2.5]octane-6-carboxamide (PubChem CID 70307015) has the molecular formula C14H24F2N4O2 and a molecular weight of 318.37 g/mol. Its IUPAC name is N-[(2S)-1-(aminomethylamino)-4,4-difluoro-1-oxopentan-2-yl]-6-azaspiro[2.5]octane-6-carboxamide.
| Compound Name | N-[(2S)-1-(aminomethylamino)-4,4-difluoro-1-oxopentan-2-yl]-6-azaspiro[2.5]octane-6-carboxamide |
|---|---|
| PubChem CID | 70307015 |
| Molecular Formula | C14H24F2N4O2 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | N-[(2S)-1-(aminomethylamino)-4,4-difluoro-1-oxopentan-2-yl]-6-azaspiro[2.5]octane-6-carboxamide |
| SMILES | CC(F)(F)C[C@H](NC(=O)N1CCC2(CC1)CC2)C(=O)NCN |
| InChI | InChI=1S/C14H24F2N4O2/c1-13(15,16)8-10(11(21)18-9-17)19-12(22)20-6-4-14(2-3-14)5-7-20/h10H,2-9,17H2,1H3,(H,18,21)(H,19,22)/t10-/m0/s1 |
| InChIKey | VSWKNNXIEFONGI-JTQLQIEISA-N |
| XLogP | 1.02 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|