C13H20ClNO3S — CID 70308526
tert-butyl N-[(2R,3R)-4-chloro-3-hydroxy-1-thiophen-2-ylbutan-2-yl]carbamate (PubChem CID 70308526) has the molecular formula C13H20ClNO3S and a molecular weight of 305.83 g/mol. Its IUPAC name is tert-butyl N-[(2R,3R)-4-chloro-3-hydroxy-1-thiophen-2-ylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3R)-4-chloro-3-hydroxy-1-thiophen-2-ylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 70308526 |
| Molecular Formula | C13H20ClNO3S |
| Molecular Weight | 305.83 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | tert-butyl N-[(2R,3R)-4-chloro-3-hydroxy-1-thiophen-2-ylbutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](Cc1cccs1)[C@@H](O)CCl |
| InChI | InChI=1S/C13H20ClNO3S/c1-13(2,3)18-12(17)15-10(11(16)8-14)7-9-5-4-6-19-9/h4-6,10-11,16H,7-8H2,1-3H3,(H,15,17)/t10-,11+/m1/s1 |
| InChIKey | QSUVVMZEWFNXCC-MNOVXSKESA-N |
| XLogP | 2.78 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.83 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|