C9H17Cl2NO3 — CID 11368909
tert-butyl N-[(2R,3S)-1,4-dichloro-3-hydroxybutan-2-yl]carbamate (PubChem CID 11368909) has the molecular formula C9H17Cl2NO3 and a molecular weight of 258.14 g/mol. Its IUPAC name is tert-butyl N-[(2R,3S)-1,4-dichloro-3-hydroxybutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3S)-1,4-dichloro-3-hydroxybutan-2-yl]carbamate |
|---|---|
| PubChem CID | 11368909 |
| Molecular Formula | C9H17Cl2NO3 |
| Molecular Weight | 258.14 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | tert-butyl N-[(2R,3S)-1,4-dichloro-3-hydroxybutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCl)[C@H](O)CCl |
| InChI | InChI=1S/C9H17Cl2NO3/c1-9(2,3)15-8(14)12-6(4-10)7(13)5-11/h6-7,13H,4-5H2,1-3H3,(H,12,14)/t6-,7+/m0/s1 |
| InChIKey | QCTWDRAREHUMBH-NKWVEPMBSA-N |
| XLogP | 1.72 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.14 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|