C9H18ClNO3S — CID 123740502
tert-butyl N-(4-chloro-3-hydroxy-2-sulfanylbutyl)carbamate (PubChem CID 123740502) has the molecular formula C9H18ClNO3S and a molecular weight of 255.77 g/mol. Its IUPAC name is tert-butyl N-(4-chloro-3-hydroxy-2-sulfanylbutyl)carbamate.
| Compound Name | tert-butyl N-(4-chloro-3-hydroxy-2-sulfanylbutyl)carbamate |
|---|---|
| PubChem CID | 123740502 |
| Molecular Formula | C9H18ClNO3S |
| Molecular Weight | 255.77 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | tert-butyl N-(4-chloro-3-hydroxy-2-sulfanylbutyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(S)C(O)CCl |
| InChI | InChI=1S/C9H18ClNO3S/c1-9(2,3)14-8(13)11-5-7(15)6(12)4-10/h6-7,12,15H,4-5H2,1-3H3,(H,11,13) |
| InChIKey | ORPPEFGJNZJJFH-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.77 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|