C22H33ClFNO3 — CID 70311716
tert-butyl (3S)-3-[(1R)-1-(3-chloro-2-fluorophenyl)-5-methoxypentyl]piperidine-1-carboxylate (PubChem CID 70311716) has the molecular formula C22H33ClFNO3 and a molecular weight of 413.96 g/mol. Its IUPAC name is tert-butyl (3S)-3-[(1R)-1-(3-chloro-2-fluorophenyl)-5-methoxypentyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[(1R)-1-(3-chloro-2-fluorophenyl)-5-methoxypentyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 70311716 |
| Molecular Formula | C22H33ClFNO3 |
| Molecular Weight | 413.96 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | tert-butyl (3S)-3-[(1R)-1-(3-chloro-2-fluorophenyl)-5-methoxypentyl]piperidine-1-carboxylate |
| SMILES | COCCCC[C@@H](c1cccc(Cl)c1F)[C@@H]1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C22H33ClFNO3/c1-22(2,3)28-21(26)25-13-8-9-16(15-25)17(10-5-6-14-27-4)18-11-7-12-19(23)20(18)24/h7,11-12,16-17H,5-6,8-10,13-15H2,1-4H3/t16-,17-/m1/s1 |
| InChIKey | NGNFEJMMGKABLI-IAGOWNOFSA-N |
| XLogP | 6.03 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.96 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|