C22H26N2O4 — CID 70313085
tert-butyl 3-(6-ethenyl-3-pyridinyl)-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 70313085) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is tert-butyl 3-(6-ethenyl-3-pyridinyl)-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | tert-butyl 3-(6-ethenyl-3-pyridinyl)-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 70313085 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | tert-butyl 3-(6-ethenyl-3-pyridinyl)-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | C=Cc1ccc(CC(NC(=O)OCc2ccccc2)C(=O)OC(C)(C)C)cn1 |
| InChI | InChI=1S/C22H26N2O4/c1-5-18-12-11-17(14-23-18)13-19(20(25)28-22(2,3)4)24-21(26)27-15-16-9-7-6-8-10-16/h5-12,14,19H,1,13,15H2,2-4H3,(H,24,26) |
| InChIKey | YRMSQFURQIZFJT-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |