C19H21F2N3O — CID 70313673
1-[4-(2,4-difluorophenyl)piperazin-1-yl]-4-pyridin-4-ylbutan-1-one (PubChem CID 70313673) has the molecular formula C19H21F2N3O and a molecular weight of 345.39 g/mol. Its IUPAC name is 1-[4-(2,4-difluorophenyl)piperazin-1-yl]-4-pyridin-4-ylbutan-1-one.
| Compound Name | 1-[4-(2,4-difluorophenyl)piperazin-1-yl]-4-pyridin-4-ylbutan-1-one |
|---|---|
| PubChem CID | 70313673 |
| Molecular Formula | C19H21F2N3O |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 1-[4-(2,4-difluorophenyl)piperazin-1-yl]-4-pyridin-4-ylbutan-1-one |
| SMILES | O=C(CCCc1ccncc1)N1CCN(c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C19H21F2N3O/c20-16-4-5-18(17(21)14-16)23-10-12-24(13-11-23)19(25)3-1-2-15-6-8-22-9-7-15/h4-9,14H,1-3,10-13H2 |
| InChIKey | NDYKQVKLUZRRFO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |