C10H9N3 — CID 70315458
3-(1,5-dihydropyrazol-2-yl)benzonitrile (PubChem CID 70315458) has the molecular formula C10H9N3 and a molecular weight of 171.20 g/mol. Its IUPAC name is 3-(1,5-dihydropyrazol-2-yl)benzonitrile.
| Compound Name | 3-(1,5-dihydropyrazol-2-yl)benzonitrile |
|---|---|
| PubChem CID | 70315458 |
| Molecular Formula | C10H9N3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | 3-(1,5-dihydropyrazol-2-yl)benzonitrile |
| SMILES | N#Cc1cccc(N2C=CCN2)c1 |
| InChI | InChI=1S/C10H9N3/c11-8-9-3-1-4-10(7-9)13-6-2-5-12-13/h1-4,6-7,12H,5H2 |
| InChIKey | FSORIBIANQAOHR-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |