C13H20BN3O3 — CID 70315691
[1-[2-(3-nitrophenyl)ethyl]-1,4-azaborinan-4-yl]oxymethanamine (PubChem CID 70315691) has the molecular formula C13H20BN3O3 and a molecular weight of 277.13 g/mol. Its IUPAC name is [1-[2-(3-nitrophenyl)ethyl]-1,4-azaborinan-4-yl]oxymethanamine.
| Compound Name | [1-[2-(3-nitrophenyl)ethyl]-1,4-azaborinan-4-yl]oxymethanamine |
|---|---|
| PubChem CID | 70315691 |
| Molecular Formula | C13H20BN3O3 |
| Molecular Weight | 277.13 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | [1-[2-(3-nitrophenyl)ethyl]-1,4-azaborinan-4-yl]oxymethanamine |
| SMILES | NCOB1CCN(CCc2cccc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C13H20BN3O3/c15-11-20-14-5-8-16(9-6-14)7-4-12-2-1-3-13(10-12)17(18)19/h1-3,10H,4-9,11,15H2 |
| InChIKey | IIVWMNGDRBNURO-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 81.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.13 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|