C25H34N6O5 — CID 70317979
tert-butyl N-[2-[[7-(6-methoxy-3-pyridinyl)-2-oxo-1-(2-propoxyethyl)pyrido[3,4-b]pyrazin-3-yl]amino]ethyl]carbamate (PubChem CID 70317979) has the molecular formula C25H34N6O5 and a molecular weight of 498.58 g/mol. Its IUPAC name is tert-butyl N-[2-[[7-(6-methoxy-3-pyridinyl)-2-oxo-1-(2-propoxyethyl)pyrido[3,4-b]pyrazin-3-yl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[7-(6-methoxy-3-pyridinyl)-2-oxo-1-(2-propoxyethyl)pyrido[3,4-b]pyrazin-3-yl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 70317979 |
| Molecular Formula | C25H34N6O5 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | tert-butyl N-[2-[[7-(6-methoxy-3-pyridinyl)-2-oxo-1-(2-propoxyethyl)pyrido[3,4-b]pyrazin-3-yl]amino]ethyl]carbamate |
| SMILES | CCCOCCn1c(=O)c(NCCNC(=O)OC(C)(C)C)nc2cnc(-c3ccc(OC)nc3)cc21 |
| InChI | InChI=1S/C25H34N6O5/c1-6-12-35-13-11-31-20-14-18(17-7-8-21(34-5)29-15-17)28-16-19(20)30-22(23(31)32)26-9-10-27-24(33)36-25(2,3)4/h7-8,14-16H,6,9-13H2,1-5H3,(H,26,30)(H,27,33) |
| InChIKey | HNGCJJXDCHFBQP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 129.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|