C22H31N6O4P — CID 143336664
3-[2-[[methoxy(methyl)phosphanyl]amino]ethylamino]-7-(6-methoxy-3-pyridinyl)-1-(2-propoxyethyl)pyrido[3,4-b]pyrazin-2-one (PubChem CID 143336664) has the molecular formula C22H31N6O4P and a molecular weight of 474.50 g/mol. Its IUPAC name is 3-[2-[[methoxy(methyl)phosphanyl]amino]ethylamino]-7-(6-methoxy-3-pyridinyl)-1-(2-propoxyethyl)pyrido[3,4-b]pyrazin-2-one.
| Compound Name | 3-[2-[[methoxy(methyl)phosphanyl]amino]ethylamino]-7-(6-methoxy-3-pyridinyl)-1-(2-propoxyethyl)pyrido[3,4-b]pyrazin-2-one |
|---|---|
| PubChem CID | 143336664 |
| Molecular Formula | C22H31N6O4P |
| Molecular Weight | 474.50 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 3-[2-[[methoxy(methyl)phosphanyl]amino]ethylamino]-7-(6-methoxy-3-pyridinyl)-1-(2-propoxyethyl)pyrido[3,4-b]pyrazin-2-one |
| SMILES | CCCOCCn1c(=O)c(NCCNP(C)OC)nc2cnc(-c3ccc(OC)nc3)cc21 |
| InChI | InChI=1S/C22H31N6O4P/c1-5-11-32-12-10-28-19-13-17(16-6-7-20(30-2)25-14-16)24-15-18(19)27-21(22(28)29)23-8-9-26-33(4)31-3/h6-7,13-15,26H,5,8-12H2,1-4H3,(H,23,27) |
| InChIKey | HXFMKBPRAXEHBB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 112.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.50 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|