C24H31N5O4 — CID 143336660
1-(2-ethoxyethyl)-3-[(4-hydroxy-4-methylcyclohexyl)amino]-7-(6-methoxy-3-pyridinyl)pyrido[3,4-b]pyrazin-2-one (PubChem CID 143336660) has the molecular formula C24H31N5O4 and a molecular weight of 453.54 g/mol. Its IUPAC name is 1-(2-ethoxyethyl)-3-[(4-hydroxy-4-methylcyclohexyl)amino]-7-(6-methoxy-3-pyridinyl)pyrido[3,4-b]pyrazin-2-one.
| Compound Name | 1-(2-ethoxyethyl)-3-[(4-hydroxy-4-methylcyclohexyl)amino]-7-(6-methoxy-3-pyridinyl)pyrido[3,4-b]pyrazin-2-one |
|---|---|
| PubChem CID | 143336660 |
| Molecular Formula | C24H31N5O4 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | 1-(2-ethoxyethyl)-3-[(4-hydroxy-4-methylcyclohexyl)amino]-7-(6-methoxy-3-pyridinyl)pyrido[3,4-b]pyrazin-2-one |
| SMILES | CCOCCn1c(=O)c(NC2CCC(C)(O)CC2)nc2cnc(-c3ccc(OC)nc3)cc21 |
| InChI | InChI=1S/C24H31N5O4/c1-4-33-12-11-29-20-13-18(16-5-6-21(32-3)26-14-16)25-15-19(20)28-22(23(29)30)27-17-7-9-24(2,31)10-8-17/h5-6,13-15,17,31H,4,7-12H2,1-3H3,(H,27,28) |
| InChIKey | LYOHUONLAJOQLH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|