C23H28FN5O3 — CID 70319470
7-(2-fluoro-4-pyridinyl)-3-[(4-hydroxycyclohexyl)amino]-1-(2-propoxyethyl)pyrido[3,4-b]pyrazin-2-one (PubChem CID 70319470) has the molecular formula C23H28FN5O3 and a molecular weight of 441.51 g/mol. Its IUPAC name is 7-(2-fluoro-4-pyridinyl)-3-[(4-hydroxycyclohexyl)amino]-1-(2-propoxyethyl)pyrido[3,4-b]pyrazin-2-one.
| Compound Name | 7-(2-fluoro-4-pyridinyl)-3-[(4-hydroxycyclohexyl)amino]-1-(2-propoxyethyl)pyrido[3,4-b]pyrazin-2-one |
|---|---|
| PubChem CID | 70319470 |
| Molecular Formula | C23H28FN5O3 |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 7-(2-fluoro-4-pyridinyl)-3-[(4-hydroxycyclohexyl)amino]-1-(2-propoxyethyl)pyrido[3,4-b]pyrazin-2-one |
| SMILES | CCCOCCn1c(=O)c(NC2CCC(O)CC2)nc2cnc(-c3ccnc(F)c3)cc21 |
| InChI | InChI=1S/C23H28FN5O3/c1-2-10-32-11-9-29-20-13-18(15-7-8-25-21(24)12-15)26-14-19(20)28-22(23(29)31)27-16-3-5-17(30)6-4-16/h7-8,12-14,16-17,30H,2-6,9-11H2,1H3,(H,27,28) |
| InChIKey | VLRUAADZWGYTNL-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|