C27H37N5O4 — CID 24964351
3-[4-(2-hydroxyethyl)piperazin-1-yl]-7-(4-propan-2-yloxyphenyl)-1-(2-propoxyethyl)pyrido[3,4-b]pyrazin-2-one (PubChem CID 24964351) has the molecular formula C27H37N5O4 and a molecular weight of 495.62 g/mol. Its IUPAC name is 3-[4-(2-hydroxyethyl)piperazin-1-yl]-7-(4-propan-2-yloxyphenyl)-1-(2-propoxyethyl)pyrido[3,4-b]pyrazin-2-one.
| Compound Name | 3-[4-(2-hydroxyethyl)piperazin-1-yl]-7-(4-propan-2-yloxyphenyl)-1-(2-propoxyethyl)pyrido[3,4-b]pyrazin-2-one |
|---|---|
| PubChem CID | 24964351 |
| Molecular Formula | C27H37N5O4 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | 3-[4-(2-hydroxyethyl)piperazin-1-yl]-7-(4-propan-2-yloxyphenyl)-1-(2-propoxyethyl)pyrido[3,4-b]pyrazin-2-one |
| SMILES | CCCOCCn1c(=O)c(N2CCN(CCO)CC2)nc2cnc(-c3ccc(OC(C)C)cc3)cc21 |
| InChI | InChI=1S/C27H37N5O4/c1-4-16-35-17-14-32-25-18-23(21-5-7-22(8-6-21)36-20(2)3)28-19-24(25)29-26(27(32)34)31-11-9-30(10-12-31)13-15-33/h5-8,18-20,33H,4,9-17H2,1-3H3 |
| InChIKey | IVCUZGCZGTVUPU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|