C23H29N5O4 — CID 70320175
7-(6-methoxy-3-pyridinyl)-3-(oxan-4-ylamino)-1-(2-propoxyethyl)pyrido[2,3-b]pyrazin-2-one (PubChem CID 70320175) has the molecular formula C23H29N5O4 and a molecular weight of 439.52 g/mol. Its IUPAC name is 7-(6-methoxy-3-pyridinyl)-3-(oxan-4-ylamino)-1-(2-propoxyethyl)pyrido[2,3-b]pyrazin-2-one.
| Compound Name | 7-(6-methoxy-3-pyridinyl)-3-(oxan-4-ylamino)-1-(2-propoxyethyl)pyrido[2,3-b]pyrazin-2-one |
|---|---|
| PubChem CID | 70320175 |
| Molecular Formula | C23H29N5O4 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | 7-(6-methoxy-3-pyridinyl)-3-(oxan-4-ylamino)-1-(2-propoxyethyl)pyrido[2,3-b]pyrazin-2-one |
| SMILES | CCCOCCn1c(=O)c(NC2CCOCC2)nc2ncc(-c3ccc(OC)nc3)cc21 |
| InChI | InChI=1S/C23H29N5O4/c1-3-9-31-12-8-28-19-13-17(16-4-5-20(30-2)24-14-16)15-25-21(19)27-22(23(28)29)26-18-6-10-32-11-7-18/h4-5,13-15,18H,3,6-12H2,1-2H3,(H,25,26,27) |
| InChIKey | IHWDRKHVDXTPGH-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|