C28H40N6O4 — CID 143336488
3-[[3-[(3S)-3-hydroxypiperidin-1-yl]-2,2-dimethylpropyl]amino]-7-(6-methoxy-3-pyridinyl)-1-(2-propoxyethyl)pyrido[2,3-b]pyrazin-2-one (PubChem CID 143336488) has the molecular formula C28H40N6O4 and a molecular weight of 524.67 g/mol. Its IUPAC name is 3-[[3-[(3S)-3-hydroxypiperidin-1-yl]-2,2-dimethylpropyl]amino]-7-(6-methoxy-3-pyridinyl)-1-(2-propoxyethyl)pyrido[2,3-b]pyrazin-2-one.
| Compound Name | 3-[[3-[(3S)-3-hydroxypiperidin-1-yl]-2,2-dimethylpropyl]amino]-7-(6-methoxy-3-pyridinyl)-1-(2-propoxyethyl)pyrido[2,3-b]pyrazin-2-one |
|---|---|
| PubChem CID | 143336488 |
| Molecular Formula | C28H40N6O4 |
| Molecular Weight | 524.67 g/mol |
| Exact Mass | 524.31 |
| IUPAC Name | 3-[[3-[(3S)-3-hydroxypiperidin-1-yl]-2,2-dimethylpropyl]amino]-7-(6-methoxy-3-pyridinyl)-1-(2-propoxyethyl)pyrido[2,3-b]pyrazin-2-one |
| SMILES | CCCOCCn1c(=O)c(NCC(C)(C)CN2CCC[C@H](O)C2)nc2ncc(-c3ccc(OC)nc3)cc21 |
| InChI | InChI=1S/C28H40N6O4/c1-5-12-38-13-11-34-23-14-21(20-8-9-24(37-4)29-15-20)16-30-25(23)32-26(27(34)36)31-18-28(2,3)19-33-10-6-7-22(35)17-33/h8-9,14-16,22,35H,5-7,10-13,17-19H2,1-4H3,(H,30,31,32)/t22-/m0/s1 |
| InChIKey | YGWXUKWABAWWHU-QFIPXVFZSA-N |
| XLogP | 3.18 |
| TPSA | 114.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.67 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|