C26H38N6O4 — CID 143336560
3-[[3-[3-hydroxypropyl(methyl)amino]-2-methylpropyl]amino]-7-(6-methoxy-3-pyridinyl)-1-(2-propoxyethyl)pyrido[2,3-b]pyrazin-2-one (PubChem CID 143336560) has the molecular formula C26H38N6O4 and a molecular weight of 498.63 g/mol. Its IUPAC name is 3-[[3-[3-hydroxypropyl(methyl)amino]-2-methylpropyl]amino]-7-(6-methoxy-3-pyridinyl)-1-(2-propoxyethyl)pyrido[2,3-b]pyrazin-2-one.
| Compound Name | 3-[[3-[3-hydroxypropyl(methyl)amino]-2-methylpropyl]amino]-7-(6-methoxy-3-pyridinyl)-1-(2-propoxyethyl)pyrido[2,3-b]pyrazin-2-one |
|---|---|
| PubChem CID | 143336560 |
| Molecular Formula | C26H38N6O4 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.30 |
| IUPAC Name | 3-[[3-[3-hydroxypropyl(methyl)amino]-2-methylpropyl]amino]-7-(6-methoxy-3-pyridinyl)-1-(2-propoxyethyl)pyrido[2,3-b]pyrazin-2-one |
| SMILES | CCCOCCn1c(=O)c(NCC(C)CN(C)CCCO)nc2ncc(-c3ccc(OC)nc3)cc21 |
| InChI | InChI=1S/C26H38N6O4/c1-5-12-36-13-10-32-22-14-21(20-7-8-23(35-4)27-16-20)17-29-24(22)30-25(26(32)34)28-15-19(2)18-31(3)9-6-11-33/h7-8,14,16-17,19,33H,5-6,9-13,15,18H2,1-4H3,(H,28,29,30) |
| InChIKey | BNYRJLYVRGUMKW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 114.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|