C24H30N6O5 — CID 70320633
3-[[2-[(3S)-3-hydroxypyrrolidin-1-yl]-2-oxoethyl]amino]-7-(6-methoxy-3-pyridinyl)-1-(2-propoxyethyl)pyrido[2,3-b]pyrazin-2-one (PubChem CID 70320633) has the molecular formula C24H30N6O5 and a molecular weight of 482.54 g/mol. Its IUPAC name is 3-[[2-[(3S)-3-hydroxypyrrolidin-1-yl]-2-oxoethyl]amino]-7-(6-methoxy-3-pyridinyl)-1-(2-propoxyethyl)pyrido[2,3-b]pyrazin-2-one.
| Compound Name | 3-[[2-[(3S)-3-hydroxypyrrolidin-1-yl]-2-oxoethyl]amino]-7-(6-methoxy-3-pyridinyl)-1-(2-propoxyethyl)pyrido[2,3-b]pyrazin-2-one |
|---|---|
| PubChem CID | 70320633 |
| Molecular Formula | C24H30N6O5 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | 3-[[2-[(3S)-3-hydroxypyrrolidin-1-yl]-2-oxoethyl]amino]-7-(6-methoxy-3-pyridinyl)-1-(2-propoxyethyl)pyrido[2,3-b]pyrazin-2-one |
| SMILES | CCCOCCn1c(=O)c(NCC(=O)N2CC[C@H](O)C2)nc2ncc(-c3ccc(OC)nc3)cc21 |
| InChI | InChI=1S/C24H30N6O5/c1-3-9-35-10-8-30-19-11-17(16-4-5-20(34-2)25-12-16)13-26-22(19)28-23(24(30)33)27-14-21(32)29-7-6-18(31)15-29/h4-5,11-13,18,31H,3,6-10,14-15H2,1-2H3,(H,26,27,28)/t18-/m0/s1 |
| InChIKey | RDSUBXPCMWRRMG-SFHVURJKSA-N |
| XLogP | 1.29 |
| TPSA | 131.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|