C24H28N8O3 — CID 70320991
7-(6-methoxy-3-pyridinyl)-1-(2-propoxyethyl)-3-[2-(pyrazin-2-ylamino)ethylamino]pyrido[2,3-b]pyrazin-2-one (PubChem CID 70320991) has the molecular formula C24H28N8O3 and a molecular weight of 476.54 g/mol. Its IUPAC name is 7-(6-methoxy-3-pyridinyl)-1-(2-propoxyethyl)-3-[2-(pyrazin-2-ylamino)ethylamino]pyrido[2,3-b]pyrazin-2-one.
| Compound Name | 7-(6-methoxy-3-pyridinyl)-1-(2-propoxyethyl)-3-[2-(pyrazin-2-ylamino)ethylamino]pyrido[2,3-b]pyrazin-2-one |
|---|---|
| PubChem CID | 70320991 |
| Molecular Formula | C24H28N8O3 |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | 7-(6-methoxy-3-pyridinyl)-1-(2-propoxyethyl)-3-[2-(pyrazin-2-ylamino)ethylamino]pyrido[2,3-b]pyrazin-2-one |
| SMILES | CCCOCCn1c(=O)c(NCCNc2cnccn2)nc2ncc(-c3ccc(OC)nc3)cc21 |
| InChI | InChI=1S/C24H28N8O3/c1-3-11-35-12-10-32-19-13-18(17-4-5-21(34-2)29-14-17)15-30-22(19)31-23(24(32)33)28-9-8-27-20-16-25-6-7-26-20/h4-7,13-16H,3,8-12H2,1-2H3,(H,26,27)(H,28,30,31) |
| InChIKey | YVAZLCUVTLXCPA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|