C14H24N2O3 — CID 70318963
tert-butyl N-[(4-carbamoyl-4-methylcyclohexen-1-yl)methyl]carbamate (PubChem CID 70318963) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is tert-butyl N-[(4-carbamoyl-4-methylcyclohexen-1-yl)methyl]carbamate.
| Compound Name | tert-butyl N-[(4-carbamoyl-4-methylcyclohexen-1-yl)methyl]carbamate |
|---|---|
| PubChem CID | 70318963 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | tert-butyl N-[(4-carbamoyl-4-methylcyclohexen-1-yl)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1=CCC(C)(C(N)=O)CC1 |
| InChI | InChI=1S/C14H24N2O3/c1-13(2,3)19-12(18)16-9-10-5-7-14(4,8-6-10)11(15)17/h5H,6-9H2,1-4H3,(H2,15,17)(H,16,18) |
| InChIKey | PISYOJMBONDSFQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|