C21H24N5O+ — CID 7032134
5-[4-(4-methylpiperazin-4-ium-1-yl)phenyl]-N-phenylpyrazole-1-carboxamide (PubChem CID 7032134) has the molecular formula C21H24N5O+ and a molecular weight of 362.46 g/mol. Its IUPAC name is 5-[4-(4-methylpiperazin-4-ium-1-yl)phenyl]-N-phenylpyrazole-1-carboxamide.
| Compound Name | 5-[4-(4-methylpiperazin-4-ium-1-yl)phenyl]-N-phenylpyrazole-1-carboxamide |
|---|---|
| PubChem CID | 7032134 |
| Molecular Formula | C21H24N5O+ |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 5-[4-(4-methylpiperazin-4-ium-1-yl)phenyl]-N-phenylpyrazole-1-carboxamide |
| SMILES | C[NH+]1CCN(c2ccc(-c3ccnn3C(=O)Nc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C21H23N5O/c1-24-13-15-25(16-14-24)19-9-7-17(8-10-19)20-11-12-22-26(20)21(27)23-18-5-3-2-4-6-18/h2-12H,13-16H2,1H3,(H,23,27)/p+1 |
| InChIKey | SRZYDFRYSQQTCO-UHFFFAOYSA-O |
| XLogP | 1.97 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |