C33H41N9O2 — CID 70322553
10-[(2R)-2-[2-[1-cyanoethyl(cyclopropyl)amino]prop-2-enylamino]propyl]-2-N,2-N,7-N,7-N-tetramethyl-10-(2H-tetrazol-5-yl)-9H-anthracene-2,7-dicarboxamide (PubChem CID 70322553) has the molecular formula C33H41N9O2 and a molecular weight of 595.75 g/mol. Its IUPAC name is 10-[(2R)-2-[2-[1-cyanoethyl(cyclopropyl)amino]prop-2-enylamino]propyl]-2-N,2-N,7-N,7-N-tetramethyl-10-(2H-tetrazol-5-yl)-9H-anthracene-2,7-dicarboxamide.
| Compound Name | 10-[(2R)-2-[2-[1-cyanoethyl(cyclopropyl)amino]prop-2-enylamino]propyl]-2-N,2-N,7-N,7-N-tetramethyl-10-(2H-tetrazol-5-yl)-9H-anthracene-2,7-dicarboxamide |
|---|---|
| PubChem CID | 70322553 |
| Molecular Formula | C33H41N9O2 |
| Molecular Weight | 595.75 g/mol |
| Exact Mass | 595.34 |
| IUPAC Name | 10-[(2R)-2-[2-[1-cyanoethyl(cyclopropyl)amino]prop-2-enylamino]propyl]-2-N,2-N,7-N,7-N-tetramethyl-10-(2H-tetrazol-5-yl)-9H-anthracene-2,7-dicarboxamide |
| SMILES | C=C(CN[C@H](C)CC1(c2nn[nH]n2)c2ccc(C(=O)N(C)C)cc2Cc2cc(C(=O)N(C)C)ccc21)N(C(C)C#N)C1CC1 |
| InChI | InChI=1S/C33H41N9O2/c1-20(35-19-22(3)42(21(2)18-34)27-10-11-27)17-33(32-36-38-39-37-32)28-12-8-23(30(43)40(4)5)14-25(28)16-26-15-24(9-13-29(26)33)31(44)41(6)7/h8-9,12-15,20-21,27,35H,3,10-11,16-17,19H2,1-2,4-7H3,(H,36,37,38,39)/t20-,21?/m1/s1 |
| InChIKey | CJUACQHVMLSSES-VQCQRNETSA-N |
| XLogP | 3.10 |
| TPSA | 134.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.75 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |