C31H37N9O3 — CID 70647452
10-[(2R)-2-[[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]amino]propyl]-2-N,2-N,7-N,7-N-tetramethyl-10-(2H-tetrazol-5-yl)-9H-anthracene-2,7-dicarboxamide (PubChem CID 70647452) has the molecular formula C31H37N9O3 and a molecular weight of 583.70 g/mol. Its IUPAC name is 10-[(2R)-2-[[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]amino]propyl]-2-N,2-N,7-N,7-N-tetramethyl-10-(2H-tetrazol-5-yl)-9H-anthracene-2,7-dicarboxamide.
| Compound Name | 10-[(2R)-2-[[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]amino]propyl]-2-N,2-N,7-N,7-N-tetramethyl-10-(2H-tetrazol-5-yl)-9H-anthracene-2,7-dicarboxamide |
|---|---|
| PubChem CID | 70647452 |
| Molecular Formula | C31H37N9O3 |
| Molecular Weight | 583.70 g/mol |
| Exact Mass | 583.30 |
| IUPAC Name | 10-[(2R)-2-[[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]amino]propyl]-2-N,2-N,7-N,7-N-tetramethyl-10-(2H-tetrazol-5-yl)-9H-anthracene-2,7-dicarboxamide |
| SMILES | C[C@H](CC1(c2nn[nH]n2)c2ccc(C(=O)N(C)C)cc2Cc2cc(C(=O)N(C)C)ccc21)NCC(=O)N1CCCC1C#N |
| InChI | InChI=1S/C31H37N9O3/c1-19(33-18-27(41)40-12-6-7-24(40)17-32)16-31(30-34-36-37-35-30)25-10-8-20(28(42)38(2)3)13-22(25)15-23-14-21(9-11-26(23)31)29(43)39(4)5/h8-11,13-14,19,24,33H,6-7,12,15-16,18H2,1-5H3,(H,34,35,36,37)/t19-,24?/m1/s1 |
| InChIKey | FGUFRQRXAIFWGF-PHSANKKPSA-N |
| XLogP | 1.72 |
| TPSA | 151.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.70 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |