C20H22N2O — CID 70325079
6-[2-(8-ethyl-3-methoxynaphthalen-2-yl)ethyl]pyridin-2-amine (PubChem CID 70325079) has the molecular formula C20H22N2O and a molecular weight of 306.41 g/mol. Its IUPAC name is 6-[2-(8-ethyl-3-methoxynaphthalen-2-yl)ethyl]pyridin-2-amine.
| Compound Name | 6-[2-(8-ethyl-3-methoxynaphthalen-2-yl)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 70325079 |
| Molecular Formula | C20H22N2O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 6-[2-(8-ethyl-3-methoxynaphthalen-2-yl)ethyl]pyridin-2-amine |
| SMILES | CCc1cccc2cc(OC)c(CCc3cccc(N)n3)cc12 |
| InChI | InChI=1S/C20H22N2O/c1-3-14-6-4-7-15-13-19(23-2)16(12-18(14)15)10-11-17-8-5-9-20(21)22-17/h4-9,12-13H,3,10-11H2,1-2H3,(H2,21,22) |
| InChIKey | QZGAKQLFAJTTGB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |