C24H28ClN3O — CID 70328830
5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-[(4-chlorophenyl)methyl]-7-ethyl-3H-isoindol-1-one (PubChem CID 70328830) has the molecular formula C24H28ClN3O and a molecular weight of 409.96 g/mol. Its IUPAC name is 5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-[(4-chlorophenyl)methyl]-7-ethyl-3H-isoindol-1-one.
| Compound Name | 5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-[(4-chlorophenyl)methyl]-7-ethyl-3H-isoindol-1-one |
|---|---|
| PubChem CID | 70328830 |
| Molecular Formula | C24H28ClN3O |
| Molecular Weight | 409.96 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-2-[(4-chlorophenyl)methyl]-7-ethyl-3H-isoindol-1-one |
| SMILES | CCc1cc(N2CCN3CCCC3C2)cc2c1C(=O)N(Cc1ccc(Cl)cc1)C2 |
| InChI | InChI=1S/C24H28ClN3O/c1-2-18-12-22(27-11-10-26-9-3-4-21(26)16-27)13-19-15-28(24(29)23(18)19)14-17-5-7-20(25)8-6-17/h5-8,12-13,21H,2-4,9-11,14-16H2,1H3 |
| InChIKey | MBHUAKZJKXCOIT-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.96 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |