C29H31N3O2 — CID 11583307
5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-7-methyl-2-[(4-phenoxyphenyl)methyl]-3H-isoindol-1-one (PubChem CID 11583307) has the molecular formula C29H31N3O2 and a molecular weight of 453.59 g/mol. Its IUPAC name is 5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-7-methyl-2-[(4-phenoxyphenyl)methyl]-3H-isoindol-1-one.
| Compound Name | 5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-7-methyl-2-[(4-phenoxyphenyl)methyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 11583307 |
| Molecular Formula | C29H31N3O2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | 5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-7-methyl-2-[(4-phenoxyphenyl)methyl]-3H-isoindol-1-one |
| SMILES | Cc1cc(N2CCN3CCCC3C2)cc2c1C(=O)N(Cc1ccc(Oc3ccccc3)cc1)C2 |
| InChI | InChI=1S/C29H31N3O2/c1-21-16-25(31-15-14-30-13-5-6-24(30)20-31)17-23-19-32(29(33)28(21)23)18-22-9-11-27(12-10-22)34-26-7-3-2-4-8-26/h2-4,7-12,16-17,24H,5-6,13-15,18-20H2,1H3 |
| InChIKey | BSJDJPKLTUFPQU-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |