C21H27N5O4 — CID 70329293
(2R,3R)-4-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-2,3-dihydroxy-4-oxo-N-[(1R)-1-(4-pyrazol-1-ylphenyl)ethyl]butanamide (PubChem CID 70329293) has the molecular formula C21H27N5O4 and a molecular weight of 413.48 g/mol. Its IUPAC name is (2R,3R)-4-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-2,3-dihydroxy-4-oxo-N-[(1R)-1-(4-pyrazol-1-ylphenyl)ethyl]butanamide.
| Compound Name | (2R,3R)-4-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-2,3-dihydroxy-4-oxo-N-[(1R)-1-(4-pyrazol-1-ylphenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 70329293 |
| Molecular Formula | C21H27N5O4 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | (2R,3R)-4-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-2,3-dihydroxy-4-oxo-N-[(1R)-1-(4-pyrazol-1-ylphenyl)ethyl]butanamide |
| SMILES | C[C@@H](NC(=O)[C@H](O)[C@@H](O)C(=O)N1CC2CNCC2C1)c1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C21H27N5O4/c1-13(14-3-5-17(6-4-14)26-8-2-7-23-26)24-20(29)18(27)19(28)21(30)25-11-15-9-22-10-16(15)12-25/h2-8,13,15-16,18-19,22,27-28H,9-12H2,1H3,(H,24,29)/t13-,15?,16?,18-,19-/m1/s1 |
| InChIKey | YEVFOUIGAMDTBV-DPMJJWQPSA-N |
| XLogP | -0.55 |
| TPSA | 119.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |