C26H32N6O4S — CID 89112078
(2R,3R)-2,3-dihydroxy-4-oxo-4-[(3R,5R)-3-[2-(propan-2-ylamino)-1,3-thiazol-4-yl]-2-azabicyclo[3.1.0]hexan-2-yl]-N-[(1R)-1-(4-pyrazol-1-ylphenyl)ethyl]butanamide (PubChem CID 89112078) has the molecular formula C26H32N6O4S and a molecular weight of 524.65 g/mol. Its IUPAC name is (2R,3R)-2,3-dihydroxy-4-oxo-4-[(3R,5R)-3-[2-(propan-2-ylamino)-1,3-thiazol-4-yl]-2-azabicyclo[3.1.0]hexan-2-yl]-N-[(1R)-1-(4-pyrazol-1-ylphenyl)ethyl]butanamide.
| Compound Name | (2R,3R)-2,3-dihydroxy-4-oxo-4-[(3R,5R)-3-[2-(propan-2-ylamino)-1,3-thiazol-4-yl]-2-azabicyclo[3.1.0]hexan-2-yl]-N-[(1R)-1-(4-pyrazol-1-ylphenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 89112078 |
| Molecular Formula | C26H32N6O4S |
| Molecular Weight | 524.65 g/mol |
| Exact Mass | 524.22 |
| IUPAC Name | (2R,3R)-2,3-dihydroxy-4-oxo-4-[(3R,5R)-3-[2-(propan-2-ylamino)-1,3-thiazol-4-yl]-2-azabicyclo[3.1.0]hexan-2-yl]-N-[(1R)-1-(4-pyrazol-1-ylphenyl)ethyl]butanamide |
| SMILES | CC(C)Nc1nc([C@H]2C[C@H]3CC3N2C(=O)[C@H](O)[C@@H](O)C(=O)N[C@H](C)c2ccc(-n3cccn3)cc2)cs1 |
| InChI | InChI=1S/C26H32N6O4S/c1-14(2)28-26-30-19(13-37-26)21-12-17-11-20(17)32(21)25(36)23(34)22(33)24(35)29-15(3)16-5-7-18(8-6-16)31-10-4-9-27-31/h4-10,13-15,17,20-23,33-34H,11-12H2,1-3H3,(H,28,30)(H,29,35)/t15-,17-,20?,21-,22-,23-/m1/s1 |
| InChIKey | YQPCMHVOSOAQCA-MVXVDDRNSA-N |
| XLogP | 2.41 |
| TPSA | 132.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.65 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |