C31H35N5O4S — CID 123849405
(2R,3R,6S)-2,3-dihydroxy-1-[(1R)-1-[2-(propan-2-ylamino)-1,3-thiazol-4-yl]-3,4-dihydro-1H-isoquinolin-2-yl]-6-(4-pyrazol-1-ylphenyl)heptane-1,4-dione (PubChem CID 123849405) has the molecular formula C31H35N5O4S and a molecular weight of 573.72 g/mol. Its IUPAC name is (2R,3R,6S)-2,3-dihydroxy-1-[(1R)-1-[2-(propan-2-ylamino)-1,3-thiazol-4-yl]-3,4-dihydro-1H-isoquinolin-2-yl]-6-(4-pyrazol-1-ylphenyl)heptane-1,4-dione.
| Compound Name | (2R,3R,6S)-2,3-dihydroxy-1-[(1R)-1-[2-(propan-2-ylamino)-1,3-thiazol-4-yl]-3,4-dihydro-1H-isoquinolin-2-yl]-6-(4-pyrazol-1-ylphenyl)heptane-1,4-dione |
|---|---|
| PubChem CID | 123849405 |
| Molecular Formula | C31H35N5O4S |
| Molecular Weight | 573.72 g/mol |
| Exact Mass | 573.24 |
| IUPAC Name | (2R,3R,6S)-2,3-dihydroxy-1-[(1R)-1-[2-(propan-2-ylamino)-1,3-thiazol-4-yl]-3,4-dihydro-1H-isoquinolin-2-yl]-6-(4-pyrazol-1-ylphenyl)heptane-1,4-dione |
| SMILES | CC(C)Nc1nc([C@H]2c3ccccc3CCN2C(=O)[C@H](O)[C@@H](O)C(=O)C[C@H](C)c2ccc(-n3cccn3)cc2)cs1 |
| InChI | InChI=1S/C31H35N5O4S/c1-19(2)33-31-34-25(18-41-31)27-24-8-5-4-7-22(24)13-16-35(27)30(40)29(39)28(38)26(37)17-20(3)21-9-11-23(12-10-21)36-15-6-14-32-36/h4-12,14-15,18-20,27-29,38-39H,13,16-17H2,1-3H3,(H,33,34)/t20-,27+,28-,29+/m0/s1 |
| InChIKey | ZEUJSMGRZSUBQN-GVGYXHIPSA-N |
| XLogP | 4.11 |
| TPSA | 120.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.72 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |