C24H29N5O6S2 — CID 123288637
N-[4-[(2R)-1-[(2R,3R,6S)-2,3-dihydroxy-4-oxo-6-(4-pyrazol-1-ylphenyl)heptanoyl]pyrrolidin-2-yl]-1,3-thiazol-2-yl]methanesulfonamide (PubChem CID 123288637) has the molecular formula C24H29N5O6S2 and a molecular weight of 547.66 g/mol. Its IUPAC name is N-[4-[(2R)-1-[(2R,3R,6S)-2,3-dihydroxy-4-oxo-6-(4-pyrazol-1-ylphenyl)heptanoyl]pyrrolidin-2-yl]-1,3-thiazol-2-yl]methanesulfonamide.
| Compound Name | N-[4-[(2R)-1-[(2R,3R,6S)-2,3-dihydroxy-4-oxo-6-(4-pyrazol-1-ylphenyl)heptanoyl]pyrrolidin-2-yl]-1,3-thiazol-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 123288637 |
| Molecular Formula | C24H29N5O6S2 |
| Molecular Weight | 547.66 g/mol |
| Exact Mass | 547.16 |
| IUPAC Name | N-[4-[(2R)-1-[(2R,3R,6S)-2,3-dihydroxy-4-oxo-6-(4-pyrazol-1-ylphenyl)heptanoyl]pyrrolidin-2-yl]-1,3-thiazol-2-yl]methanesulfonamide |
| SMILES | C[C@@H](CC(=O)[C@H](O)[C@@H](O)C(=O)N1CCC[C@@H]1c1csc(NS(C)(=O)=O)n1)c1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C24H29N5O6S2/c1-15(16-6-8-17(9-7-16)29-12-4-10-25-29)13-20(30)21(31)22(32)23(33)28-11-3-5-19(28)18-14-36-24(26-18)27-37(2,34)35/h4,6-10,12,14-15,19,21-22,31-32H,3,5,11,13H2,1-2H3,(H,26,27)/t15-,19+,21-,22+/m0/s1 |
| InChIKey | WMYSVSYMLHTJRX-YWASFDNLSA-N |
| XLogP | 1.85 |
| TPSA | 154.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.66 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |