C16H16N2O4S2 — CID 70331122
N-(4-methoxyphenyl)-2,6-dimethyl-1,3-dioxo-4H-thieno[2,3-e]thiazine-4-carboxamide (PubChem CID 70331122) has the molecular formula C16H16N2O4S2 and a molecular weight of 364.45 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2,6-dimethyl-1,3-dioxo-4H-thieno[2,3-e]thiazine-4-carboxamide.
| Compound Name | N-(4-methoxyphenyl)-2,6-dimethyl-1,3-dioxo-4H-thieno[2,3-e]thiazine-4-carboxamide |
|---|---|
| PubChem CID | 70331122 |
| Molecular Formula | C16H16N2O4S2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | N-(4-methoxyphenyl)-2,6-dimethyl-1,3-dioxo-4H-thieno[2,3-e]thiazine-4-carboxamide |
| SMILES | COc1ccc(NC(=O)C2C(=O)N(C)S(=O)c3cc(C)sc32)cc1 |
| InChI | InChI=1S/C16H16N2O4S2/c1-9-8-12-14(23-9)13(16(20)18(2)24(12)21)15(19)17-10-4-6-11(22-3)7-5-10/h4-8,13H,1-3H3,(H,17,19) |
| InChIKey | SGDMWUIHEMIHQD-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|