C27H43N5O5 — CID 70331378
(1R,2S,5S)-3-[(2S)-2-[carbamoyl(methyl)amino]-2-cyclohexylacetyl]-N-[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 70331378) has the molecular formula C27H43N5O5 and a molecular weight of 517.67 g/mol. Its IUPAC name is (1R,2S,5S)-3-[(2S)-2-[carbamoyl(methyl)amino]-2-cyclohexylacetyl]-N-[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | (1R,2S,5S)-3-[(2S)-2-[carbamoyl(methyl)amino]-2-cyclohexylacetyl]-N-[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 70331378 |
| Molecular Formula | C27H43N5O5 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.33 |
| IUPAC Name | (1R,2S,5S)-3-[(2S)-2-[carbamoyl(methyl)amino]-2-cyclohexylacetyl]-N-[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | C=CCNC(=O)C(=O)C(CCC)NC(=O)[C@@H]1[C@@H]2[C@H](CN1C(=O)[C@H](C1CCCCC1)N(C)C(N)=O)C2(C)C |
| InChI | InChI=1S/C27H43N5O5/c1-6-11-18(22(33)24(35)29-14-7-2)30-23(34)21-19-17(27(19,3)4)15-32(21)25(36)20(31(5)26(28)37)16-12-9-8-10-13-16/h7,16-21H,2,6,8-15H2,1,3-5H3,(H2,28,37)(H,29,35)(H,30,34)/t17-,18?,19-,20-,21-/m0/s1 |
| InChIKey | BKMJRELXVVMCKL-LIELFMAKSA-N |
| XLogP | 1.59 |
| TPSA | 141.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|