C23H38N4O4 — CID 70331813
(3S,3aS,6aS)-N-(4-amino-1-cyclopropyl-3,4-dioxobutan-2-yl)-2-[(2S)-2-amino-3,3-dimethylbutanoyl]-6,6-dimethyl-1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrole-3-carboxamide (PubChem CID 70331813) has the molecular formula C23H38N4O4 and a molecular weight of 434.58 g/mol. Its IUPAC name is (3S,3aS,6aS)-N-(4-amino-1-cyclopropyl-3,4-dioxobutan-2-yl)-2-[(2S)-2-amino-3,3-dimethylbutanoyl]-6,6-dimethyl-1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrole-3-carboxamide.
| Compound Name | (3S,3aS,6aS)-N-(4-amino-1-cyclopropyl-3,4-dioxobutan-2-yl)-2-[(2S)-2-amino-3,3-dimethylbutanoyl]-6,6-dimethyl-1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 70331813 |
| Molecular Formula | C23H38N4O4 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | (3S,3aS,6aS)-N-(4-amino-1-cyclopropyl-3,4-dioxobutan-2-yl)-2-[(2S)-2-amino-3,3-dimethylbutanoyl]-6,6-dimethyl-1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrole-3-carboxamide |
| SMILES | CC(C)(C)[C@H](N)C(=O)N1C[C@H]2[C@H](CCC2(C)C)[C@H]1C(=O)NC(CC1CC1)C(=O)C(N)=O |
| InChI | InChI=1S/C23H38N4O4/c1-22(2,3)18(24)21(31)27-11-14-13(8-9-23(14,4)5)16(27)20(30)26-15(10-12-6-7-12)17(28)19(25)29/h12-16,18H,6-11,24H2,1-5H3,(H2,25,29)(H,26,30)/t13-,14-,15?,16-,18+/m0/s1 |
| InChIKey | GHTJGNHMHAGBKK-ILNDBMBRSA-N |
| XLogP | 0.96 |
| TPSA | 135.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|