C25H40N4O4 — CID 70316526
(3S,3aS,6aS)-2-[(2S)-2-amino-2-cyclohexylacetyl]-N-(4-amino-1-cyclopropyl-3,4-dioxobutan-2-yl)-6,6-dimethyl-1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrole-3-carboxamide (PubChem CID 70316526) has the molecular formula C25H40N4O4 and a molecular weight of 460.62 g/mol. Its IUPAC name is (3S,3aS,6aS)-2-[(2S)-2-amino-2-cyclohexylacetyl]-N-(4-amino-1-cyclopropyl-3,4-dioxobutan-2-yl)-6,6-dimethyl-1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrole-3-carboxamide.
| Compound Name | (3S,3aS,6aS)-2-[(2S)-2-amino-2-cyclohexylacetyl]-N-(4-amino-1-cyclopropyl-3,4-dioxobutan-2-yl)-6,6-dimethyl-1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 70316526 |
| Molecular Formula | C25H40N4O4 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.30 |
| IUPAC Name | (3S,3aS,6aS)-2-[(2S)-2-amino-2-cyclohexylacetyl]-N-(4-amino-1-cyclopropyl-3,4-dioxobutan-2-yl)-6,6-dimethyl-1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrole-3-carboxamide |
| SMILES | CC1(C)CC[C@@H]2[C@@H](C(=O)NC(CC3CC3)C(=O)C(N)=O)N(C(=O)[C@@H](N)C3CCCCC3)C[C@@H]21 |
| InChI | InChI=1S/C25H40N4O4/c1-25(2)11-10-16-17(25)13-29(24(33)19(26)15-6-4-3-5-7-15)20(16)23(32)28-18(12-14-8-9-14)21(30)22(27)31/h14-20H,3-13,26H2,1-2H3,(H2,27,31)(H,28,32)/t16-,17-,18?,19-,20-/m0/s1 |
| InChIKey | QFQBIBBXEZECKJ-NDZPQQBLSA-N |
| XLogP | 1.50 |
| TPSA | 135.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|