C28H44N4O4 — CID 70319964
(3S,3aS,6aS)-2-[(2S)-2-amino-2-cyclohexylacetyl]-N-[1,2-dioxo-1-(prop-2-enylamino)heptan-3-yl]spiro[1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrole-6,1'-cyclopropane]-3-carboxamide (PubChem CID 70319964) has the molecular formula C28H44N4O4 and a molecular weight of 500.68 g/mol. Its IUPAC name is (3S,3aS,6aS)-2-[(2S)-2-amino-2-cyclohexylacetyl]-N-[1,2-dioxo-1-(prop-2-enylamino)heptan-3-yl]spiro[1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrole-6,1'-cyclopropane]-3-carboxamide.
| Compound Name | (3S,3aS,6aS)-2-[(2S)-2-amino-2-cyclohexylacetyl]-N-[1,2-dioxo-1-(prop-2-enylamino)heptan-3-yl]spiro[1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrole-6,1'-cyclopropane]-3-carboxamide |
|---|---|
| PubChem CID | 70319964 |
| Molecular Formula | C28H44N4O4 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.34 |
| IUPAC Name | (3S,3aS,6aS)-2-[(2S)-2-amino-2-cyclohexylacetyl]-N-[1,2-dioxo-1-(prop-2-enylamino)heptan-3-yl]spiro[1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrole-6,1'-cyclopropane]-3-carboxamide |
| SMILES | C=CCNC(=O)C(=O)C(CCCC)NC(=O)[C@@H]1[C@H]2CCC3(CC3)[C@H]2CN1C(=O)[C@@H](N)C1CCCCC1 |
| InChI | InChI=1S/C28H44N4O4/c1-3-5-11-21(24(33)26(35)30-16-4-2)31-25(34)23-19-12-13-28(14-15-28)20(19)17-32(23)27(36)22(29)18-9-7-6-8-10-18/h4,18-23H,2-3,5-17,29H2,1H3,(H,30,35)(H,31,34)/t19-,20-,21?,22-,23-/m0/s1 |
| InChIKey | VSSPVAACLRZVJI-CXFLKDOESA-N |
| XLogP | 2.46 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|