C15H16INO2 — CID 70339062
4-(2-iodophenyl)-2,5,6-trimethyl-1,4-dihydropyridine-3-carboxylic acid (PubChem CID 70339062) has the molecular formula C15H16INO2 and a molecular weight of 369.20 g/mol. Its IUPAC name is 4-(2-iodophenyl)-2,5,6-trimethyl-1,4-dihydropyridine-3-carboxylic acid.
| Compound Name | 4-(2-iodophenyl)-2,5,6-trimethyl-1,4-dihydropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 70339062 |
| Molecular Formula | C15H16INO2 |
| Molecular Weight | 369.20 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | 4-(2-iodophenyl)-2,5,6-trimethyl-1,4-dihydropyridine-3-carboxylic acid |
| SMILES | CC1=C(C)C(c2ccccc2I)C(C(=O)O)=C(C)N1 |
| InChI | InChI=1S/C15H16INO2/c1-8-9(2)17-10(3)14(15(18)19)13(8)11-6-4-5-7-12(11)16/h4-7,13,17H,1-3H3,(H,18,19) |
| InChIKey | MKBKTSVXCAYHOD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.20 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|