C23H25N3O5S — CID 70342401
N-[(2-ethoxyphenyl)methyl]-6-morpholin-4-ylsulfinyl-2-oxo-1H-quinoline-4-carboxamide (PubChem CID 70342401) has the molecular formula C23H25N3O5S and a molecular weight of 455.54 g/mol. Its IUPAC name is N-[(2-ethoxyphenyl)methyl]-6-morpholin-4-ylsulfinyl-2-oxo-1H-quinoline-4-carboxamide.
| Compound Name | N-[(2-ethoxyphenyl)methyl]-6-morpholin-4-ylsulfinyl-2-oxo-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 70342401 |
| Molecular Formula | C23H25N3O5S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | N-[(2-ethoxyphenyl)methyl]-6-morpholin-4-ylsulfinyl-2-oxo-1H-quinoline-4-carboxamide |
| SMILES | CCOc1ccccc1CNC(=O)c1cc(=O)[nH]c2ccc(S(=O)N3CCOCC3)cc12 |
| InChI | InChI=1S/C23H25N3O5S/c1-2-31-21-6-4-3-5-16(21)15-24-23(28)19-14-22(27)25-20-8-7-17(13-18(19)20)32(29)26-9-11-30-12-10-26/h3-8,13-14H,2,9-12,15H2,1H3,(H,24,28)(H,25,27) |
| InChIKey | GKFUYXCORKHKJX-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 100.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |