C35H24N4O — CID 70342537
4-[[7-(cyanomethoxy)indol-1-yl]-[3-[(E)-2-quinolin-2-ylethenyl]phenyl]methyl]benzonitrile (PubChem CID 70342537) has the molecular formula C35H24N4O and a molecular weight of 516.60 g/mol. Its IUPAC name is 4-[[7-(cyanomethoxy)indol-1-yl]-[3-[(E)-2-quinolin-2-ylethenyl]phenyl]methyl]benzonitrile.
| Compound Name | 4-[[7-(cyanomethoxy)indol-1-yl]-[3-[(E)-2-quinolin-2-ylethenyl]phenyl]methyl]benzonitrile |
|---|---|
| PubChem CID | 70342537 |
| Molecular Formula | C35H24N4O |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | 4-[[7-(cyanomethoxy)indol-1-yl]-[3-[(E)-2-quinolin-2-ylethenyl]phenyl]methyl]benzonitrile |
| SMILES | N#CCOc1cccc2ccn(C(c3ccc(C#N)cc3)c3cccc(/C=C/c4ccc5ccccc5n4)c3)c12 |
| InChI | InChI=1S/C35H24N4O/c36-20-22-40-33-10-4-7-28-19-21-39(35(28)33)34(29-14-11-26(24-37)12-15-29)30-8-3-5-25(23-30)13-17-31-18-16-27-6-1-2-9-32(27)38-31/h1-19,21,23,34H,22H2/b17-13+ |
| InChIKey | ISHJGOYCCZPYLQ-GHRIWEEISA-N |
| XLogP | 7.77 |
| TPSA | 74.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |