C23H22N4O4S — CID 70343227
[2-(furan-2-yl)-6-(4-methylpiperidin-1-yl)sulfonylquinolin-4-yl]-imidazol-1-ylmethanone (PubChem CID 70343227) has the molecular formula C23H22N4O4S and a molecular weight of 450.52 g/mol. Its IUPAC name is [2-(furan-2-yl)-6-(4-methylpiperidin-1-yl)sulfonylquinolin-4-yl]-imidazol-1-ylmethanone.
| Compound Name | [2-(furan-2-yl)-6-(4-methylpiperidin-1-yl)sulfonylquinolin-4-yl]-imidazol-1-ylmethanone |
|---|---|
| PubChem CID | 70343227 |
| Molecular Formula | C23H22N4O4S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | [2-(furan-2-yl)-6-(4-methylpiperidin-1-yl)sulfonylquinolin-4-yl]-imidazol-1-ylmethanone |
| SMILES | CC1CCN(S(=O)(=O)c2ccc3nc(-c4ccco4)cc(C(=O)n4ccnc4)c3c2)CC1 |
| InChI | InChI=1S/C23H22N4O4S/c1-16-6-9-27(10-7-16)32(29,30)17-4-5-20-18(13-17)19(23(28)26-11-8-24-15-26)14-21(25-20)22-3-2-12-31-22/h2-5,8,11-16H,6-7,9-10H2,1H3 |
| InChIKey | VWVGSIUYELOZIV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 98.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |