C19H26N6O3 — CID 70343504
oxolane-2-carboximidoyl 1-ethyl-4-(oxan-4-ylamino)pyrazolo[3,4-b]pyridine-5-carboximidate (PubChem CID 70343504) has the molecular formula C19H26N6O3 and a molecular weight of 386.46 g/mol. Its IUPAC name is oxolane-2-carboximidoyl 1-ethyl-4-(oxan-4-ylamino)pyrazolo[3,4-b]pyridine-5-carboximidate.
| Compound Name | oxolane-2-carboximidoyl 1-ethyl-4-(oxan-4-ylamino)pyrazolo[3,4-b]pyridine-5-carboximidate |
|---|---|
| PubChem CID | 70343504 |
| Molecular Formula | C19H26N6O3 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | oxolane-2-carboximidoyl 1-ethyl-4-(oxan-4-ylamino)pyrazolo[3,4-b]pyridine-5-carboximidate |
| SMILES | [H]/N=C(\O/C(=N/[H])C1CCCO1)c1cnc2c(cnn2CC)c1NC1CCOCC1 |
| InChI | InChI=1S/C19H26N6O3/c1-2-25-19-14(11-23-25)16(24-12-5-8-26-9-6-12)13(10-22-19)17(20)28-18(21)15-4-3-7-27-15/h10-12,15,20-21H,2-9H2,1H3,(H,22,24)/b20-17-,21-18+ |
| InChIKey | RAIYFEQGNCANSM-WPDZNWIASA-N |
| XLogP | 2.54 |
| TPSA | 118.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|