C13H21F3 — CID 70345646
1-methyl-1-propan-2-yl-4-(1,1,1-trifluoropropan-2-ylidene)cyclohexane (PubChem CID 70345646) has the molecular formula C13H21F3 and a molecular weight of 234.30 g/mol. Its IUPAC name is 1-methyl-1-propan-2-yl-4-(1,1,1-trifluoropropan-2-ylidene)cyclohexane.
| Compound Name | 1-methyl-1-propan-2-yl-4-(1,1,1-trifluoropropan-2-ylidene)cyclohexane |
|---|---|
| PubChem CID | 70345646 |
| Molecular Formula | C13H21F3 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 1-methyl-1-propan-2-yl-4-(1,1,1-trifluoropropan-2-ylidene)cyclohexane |
| SMILES | CC(=C1CCC(C)(C(C)C)CC1)C(F)(F)F |
| InChI | InChI=1S/C13H21F3/c1-9(2)12(4)7-5-11(6-8-12)10(3)13(14,15)16/h9H,5-8H2,1-4H3/b11-10- |
| InChIKey | CYRIOKAJMZFUNE-KHPPLWFESA-N |
| XLogP | 5.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|