C15H13Cl2N3 — CID 70348639
[1-[(3,5-dichlorophenyl)methyl]benzimidazol-2-yl]methanamine (PubChem CID 70348639) has the molecular formula C15H13Cl2N3 and a molecular weight of 306.20 g/mol. Its IUPAC name is [1-[(3,5-dichlorophenyl)methyl]benzimidazol-2-yl]methanamine.
| Compound Name | [1-[(3,5-dichlorophenyl)methyl]benzimidazol-2-yl]methanamine |
|---|---|
| PubChem CID | 70348639 |
| Molecular Formula | C15H13Cl2N3 |
| Molecular Weight | 306.20 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | [1-[(3,5-dichlorophenyl)methyl]benzimidazol-2-yl]methanamine |
| SMILES | NCc1nc2ccccc2n1Cc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C15H13Cl2N3/c16-11-5-10(6-12(17)7-11)9-20-14-4-2-1-3-13(14)19-15(20)8-18/h1-7H,8-9,18H2 |
| InChIKey | CBONUVBGCCJVDU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.20 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |