C16H21NO — CID 70351108
5-(4,6,7-trimethyl-1H-indol-3-yl)pent-1-en-2-ol (PubChem CID 70351108) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is 5-(4,6,7-trimethyl-1H-indol-3-yl)pent-1-en-2-ol.
| Compound Name | 5-(4,6,7-trimethyl-1H-indol-3-yl)pent-1-en-2-ol |
|---|---|
| PubChem CID | 70351108 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | 5-(4,6,7-trimethyl-1H-indol-3-yl)pent-1-en-2-ol |
| SMILES | C=C(O)CCCc1c[nH]c2c(C)c(C)cc(C)c12 |
| InChI | InChI=1S/C16H21NO/c1-10-8-11(2)15-14(7-5-6-12(3)18)9-17-16(15)13(10)4/h8-9,17-18H,3,5-7H2,1-2,4H3 |
| InChIKey | BASDBKMFVIBWRF-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|