C19H22N2O3 — CID 70351149
3-methyl-2-(4-phenylbutylcarbamoylamino)benzoic acid (PubChem CID 70351149) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is 3-methyl-2-(4-phenylbutylcarbamoylamino)benzoic acid.
| Compound Name | 3-methyl-2-(4-phenylbutylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 70351149 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 3-methyl-2-(4-phenylbutylcarbamoylamino)benzoic acid |
| SMILES | Cc1cccc(C(=O)O)c1NC(=O)NCCCCc1ccccc1 |
| InChI | InChI=1S/C19H22N2O3/c1-14-8-7-12-16(18(22)23)17(14)21-19(24)20-13-6-5-11-15-9-3-2-4-10-15/h2-4,7-10,12H,5-6,11,13H2,1H3,(H,22,23)(H2,20,21,24) |
| InChIKey | JGTFENQNVSOEDL-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|