C12H16NO4+ — CID 70352068
5-(3,4-dimethoxyphenyl)-5-methyl-1,3-oxazolidin-3-ium 3-oxide (PubChem CID 70352068) has the molecular formula C12H16NO4+ and a molecular weight of 238.26 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-5-methyl-1,3-oxazolidin-3-ium 3-oxide.
| Compound Name | 5-(3,4-dimethoxyphenyl)-5-methyl-1,3-oxazolidin-3-ium 3-oxide |
|---|---|
| PubChem CID | 70352068 |
| Molecular Formula | C12H16NO4+ |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-5-methyl-1,3-oxazolidin-3-ium 3-oxide |
| SMILES | COc1ccc(C2(C)C[N+](=O)CO2)cc1OC |
| InChI | InChI=1S/C12H16NO4/c1-12(7-13(14)8-17-12)9-4-5-10(15-2)11(6-9)16-3/h4-6H,7-8H2,1-3H3/q+1 |
| InChIKey | DOHXVCYWAAAWFW-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 47.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|