C15H24O2S2Si — CID 10711399
[2-(3,4-dimethoxyphenyl)-1,3-dithian-2-yl]-trimethylsilane (PubChem CID 10711399) has the molecular formula C15H24O2S2Si and a molecular weight of 328.58 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)-1,3-dithian-2-yl]-trimethylsilane.
| Compound Name | [2-(3,4-dimethoxyphenyl)-1,3-dithian-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 10711399 |
| Molecular Formula | C15H24O2S2Si |
| Molecular Weight | 328.58 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | [2-(3,4-dimethoxyphenyl)-1,3-dithian-2-yl]-trimethylsilane |
| SMILES | COc1ccc(C2([Si](C)(C)C)SCCCS2)cc1OC |
| InChI | InChI=1S/C15H24O2S2Si/c1-16-13-8-7-12(11-14(13)17-2)15(20(3,4)5)18-9-6-10-19-15/h7-8,11H,6,9-10H2,1-5H3 |
| InChIKey | SZFZHMPIFLXDLJ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.58 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|